Compound Q&A

What are the physical and chemical properties of 2,2',3,4',5,6-Hexachlorobiphenyl (CAS: 68194-13-8)?

Answer

2,2',3,4',5,6-Hexachlorobiphenyl
2,2',3,4',5,6-Hexachlorobiphenyl is a crystalline solid with a high molecular weight and limited solubility in common solvents. It is not very reactive under normal conditions. The compound has a melting point of approximately 300°C and is not readily biodegradable.

About

CAS No 68194-13-8
English Name 2,2',3,4',5,6-Hexachlorobiphenyl
Molecular Formula C12H4Cl6
Molecular Weight 360.88 g/mol
SMILES C1=CC(=C(C=C1Cl)Cl)C2=C(C(=CC(=C2Cl)Cl)Cl)Cl
InChIKey AQONCPKMJSBHQT-UHFFFAOYSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

How is 2,2',3,4',5,6-Hexachlorobiphenyl (CAS: 68194-13-8) typically synthesized?

2,2',3,4',5,6-Hexachlorobiphenyl is typically synthesized through a series of chlorination reactions...

Compound Q&A

What industries use 2,2',3,4',5,6-Hexachlorobiphenyl (CAS: 68194-13-8)?

2,2',3,4',5,6-Hexachlorobiphenyl was historically used in the production of flame retardants, but it...

Compound Q&A

What precautions should be taken when handling 2,2',3,4',5,6-Hexachlorobiphenyl (CAS: 68194-13-8)?

When handling 2,2',3,4',5,6-Hexachlorobiphenyl, it is essential to use personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...