Compound Q&A

What industries use 2,3-Dimethoxystrychnidin-10-one hydrate (CAS: 5892-11-5)?

Answer

2,3-Dimethoxystrychnidin-10-one hydrate (1:1)
2,3-Dimethoxystrychnidin-10-one hydrate (CAS: 5892-11-5) is primarily used in the pharmaceutical industry for the synthesis of medicinal compounds. It also has potential applications in the polymer industry for the development of specialized polymers and in the sensor industry for the creation of advanced sensor materials.

About

CAS No 5892-11-5
English Name 2,3-Dimethoxystrychnidin-10-one hydrate (1:1)
Molecular Formula C23H28N2O5
Molecular Weight 430.5 g/mol
SMILES COC1=C(C=C2C(=C1)C34CCN5C3CC6C7C4N2C(=O)CC7OCC=C6C5)OC.O.O
InChIKey IEJIBKWJYHZFNW-SUJBTXFYSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3-Dimethoxystrychnidin-10-one hydrate (CAS: 5892-11-5)?

2,3-Dimethoxystrychnidin-10-one hydrate (CAS: 5892-11-5) is a crystalline compound with a molecular ...

Compound Q&A

How is 2,3-Dimethoxystrychnidin-10-one hydrate (CAS: 5892-11-5) typically synthesized?

2,3-Dimethoxystrychnidin-10-one hydrate (CAS: 5892-11-5) is typically synthesized through a condensa...

Compound Q&A

What precautions should be taken when handling 2,3-Dimethoxystrychnidin-10-one hydrate (CAS: 5892-11-5)?

When handling 2,3-Dimethoxystrychnidin-10-one hydrate (CAS: 5892-11-5), it is essential to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...