Compound Q&A

What are the physical and chemical properties of 2,3-Dimethoxystrychnidin-10-one hydrate (CAS: 5892-11-5)?

Answer

2,3-Dimethoxystrychnidin-10-one hydrate (1:1)
2,3-Dimethoxystrychnidin-10-one hydrate (CAS: 5892-11-5) is a crystalline compound with a molecular weight of approximately 302.25 g/mol. It has a solubility of about 0.5 g/100 mL in water. Chemically, it is relatively stable but can react with strong acids and bases. It forms a 1:1 hydrate with water, which affects its solubility and reactivity.

About

CAS No 5892-11-5
English Name 2,3-Dimethoxystrychnidin-10-one hydrate (1:1)
Molecular Formula C23H28N2O5
Molecular Weight 430.5 g/mol
SMILES COC1=C(C=C2C(=C1)C34CCN5C3CC6C7C4N2C(=O)CC7OCC=C6C5)OC.O.O
InChIKey IEJIBKWJYHZFNW-SUJBTXFYSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

How is 2,3-Dimethoxystrychnidin-10-one hydrate (CAS: 5892-11-5) typically synthesized?

2,3-Dimethoxystrychnidin-10-one hydrate (CAS: 5892-11-5) is typically synthesized through a condensa...

Compound Q&A

What industries use 2,3-Dimethoxystrychnidin-10-one hydrate (CAS: 5892-11-5)?

2,3-Dimethoxystrychnidin-10-one hydrate (CAS: 5892-11-5) is primarily used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling 2,3-Dimethoxystrychnidin-10-one hydrate (CAS: 5892-11-5)?

When handling 2,3-Dimethoxystrychnidin-10-one hydrate (CAS: 5892-11-5), it is essential to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...