Compound Q&A

What precautions should be taken when handling Diethoxy(diisobutyl)silane (CAS: 18297-14-8)?

Answer

Diethoxy(diisobutyl)silane
When handling Diethoxy(diisobutyl)silane (CAS: 18297-14-8), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The substance should be handled under a fume hood to avoid inhalation. Spills should be cleaned up using appropriate absorbents, and the area should be well-ventilated. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal information.

About

CAS No 18297-14-8
English Name Diethoxy(diisobutyl)silane
Molecular Formula C12H28O2Si
Molecular Weight 232.44 g/mol
SMILES CCO[Si](CC(C)C)(CC(C)C)OCC
InChIKey WOZOEHNJNZTJDH-UHFFFAOYSA-N
Last Updated: 2026-03-22 19:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diethoxy(diisobutyl)silane (CAS: 18297-14-8)?

Diethoxy(diisobutyl)silane (CAS: 18297-14-8) is a colorless to slightly yellow, flammable liquid wit...

Compound Q&A

How is Diethoxy(diisobutyl)silane (CAS: 18297-14-8) typically synthesized?

Diethoxy(diisobutyl)silane (CAS: 18297-14-8) is typically synthesized through the reaction of diisob...

Compound Q&A

What industries use Diethoxy(diisobutyl)silane (CAS: 18297-14-8)?

Diethoxy(diisobutyl)silane (CAS: 18297-14-8) is used in various industries, particularly in the prod...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...