Compound Q&A

What are the physical and chemical properties of Diethoxy(diisobutyl)silane (CAS: 18297-14-8)?

Answer

Diethoxy(diisobutyl)silane
Diethoxy(diisobutyl)silane (CAS: 18297-14-8) is a colorless to slightly yellow, flammable liquid with a molecular weight of approximately 250.43 g/mol. It has a low solubility in water and is soluble in organic solvents. The compound is reactive and can undergo hydrolysis, making it important to handle under an inert atmosphere. It has a boiling point of around 160°C and a melting point of -32°C.

About

CAS No 18297-14-8
English Name Diethoxy(diisobutyl)silane
Molecular Formula C12H28O2Si
Molecular Weight 232.44 g/mol
SMILES CCO[Si](CC(C)C)(CC(C)C)OCC
InChIKey WOZOEHNJNZTJDH-UHFFFAOYSA-N
Last Updated: 2026-03-22 19:38

Related Q&A

Compound Q&A

How is Diethoxy(diisobutyl)silane (CAS: 18297-14-8) typically synthesized?

Diethoxy(diisobutyl)silane (CAS: 18297-14-8) is typically synthesized through the reaction of diisob...

Compound Q&A

What industries use Diethoxy(diisobutyl)silane (CAS: 18297-14-8)?

Diethoxy(diisobutyl)silane (CAS: 18297-14-8) is used in various industries, particularly in the prod...

Compound Q&A

What precautions should be taken when handling Diethoxy(diisobutyl)silane (CAS: 18297-14-8)?

When handling Diethoxy(diisobutyl)silane (CAS: 18297-14-8), it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...