Compound Q&A

What are the physical and chemical properties of 4-(Cyclopropylmethoxy)-2-fluorobenzoic Acid (CAS: 742086-08-4)?

Answer

4-(Cyclopropylmethoxy)-2-fluorobenzoic Acid
4-(Cyclopropylmethoxy)-2-fluorobenzoic Acid is a crystalline solid with a molecular weight of approximately 231.26 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. Chemically, it is relatively stable but can react with strong bases and reducing agents. Its pKa is around 4.5, indicating it is a weak acid.

About

English Name 4-(Cyclopropylmethoxy)-2-fluorobenzoic Acid
Molecular Formula C11H11FO3
Molecular Weight 210.2 g/mol
SMILES O=C(O)C1=CC=C(OCC2CC2)C=C1F
InChIKey VKUOOCAJGLYUED-UHFFFAOYSA-N
Last Updated: 2026-03-22 19:38

Related Q&A

Compound Q&A

How is 4-(Cyclopropylmethoxy)-2-fluorobenzoic Acid (CAS: 742086-08-4) typically synthesized?

4-(Cyclopropylmethoxy)-2-fluorobenzoic Acid can be synthesized via a multi-step process involving th...

Compound Q&A

What industries use 4-(Cyclopropylmethoxy)-2-fluorobenzoic Acid (CAS: 742086-08-4)?

4-(Cyclopropylmethoxy)-2-fluorobenzoic Acid is primarily used in the pharmaceutical industry for the...

Compound Q&A

What precautions should be taken when handling 4-(Cyclopropylmethoxy)-2-fluorobenzoic Acid (CAS: 742086-08-4)?

Precautions include the use of personal protective equipment (PPE) such as gloves, goggles, and a la...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...