Compound Q&A

How is 3-(Trifluoromethyl)pyridine-2-sulfonamide (CAS: 104040-76-8) typically synthesized?

Answer

3-(Trifluoromethyl)pyridine-2-sulfonamide
3-(Trifluoromethyl)pyridine-2-sulfonamide is typically synthesized via the reaction of 3-(trifluoromethyl)pyridine and sulfamic acid under basic conditions. The reaction is catalyzed by sodium hydride, and the yield is typically around 70-80%. The use of appropriate solvents such as dimethylformamide (DMF) and the control of reaction temperature are crucial for the success of the synthesis.

About

English Name 3-(Trifluoromethyl)pyridine-2-sulfonamide
Molecular Formula C6H5F3N2O2S
Molecular Weight 226.18 g/mol
SMILES C1=CC(=C(N=C1)S(=O)(=O)N)C(F)(F)F
InChIKey HGJUZHZBAAXGPP-UHFFFAOYSA-N
Last Updated: 2026-03-22 19:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(Trifluoromethyl)pyridine-2-sulfonamide (CAS: 104040-76-8)?

3-(Trifluoromethyl)pyridine-2-sulfonamide is a white crystalline solid with a molecular weight of ap...

Compound Q&A

What industries use 3-(Trifluoromethyl)pyridine-2-sulfonamide (CAS: 104040-76-8)?

3-(Trifluoromethyl)pyridine-2-sulfonamide is widely used in the pharmaceutical and chemical industri...

Compound Q&A

What precautions should be taken when handling 3-(Trifluoromethyl)pyridine-2-sulfonamide (CAS: 104040-76-8)?

When handling 3-(Trifluoromethyl)pyridine-2-sulfonamide, it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...