Compound Q&A

What are the physical and chemical properties of 3-(Trifluoromethyl)pyridine-2-sulfonamide (CAS: 104040-76-8)?

Answer

3-(Trifluoromethyl)pyridine-2-sulfonamide
3-(Trifluoromethyl)pyridine-2-sulfonamide is a white crystalline solid with a molecular weight of approximately 286.12 g/mol. It has good solubility in common organic solvents such as DMSO and poor solubility in water. This compound exhibits good stability under normal conditions but can be reactive towards strong bases. It is used in various applications requiring its unique chemical properties.

About

English Name 3-(Trifluoromethyl)pyridine-2-sulfonamide
Molecular Formula C6H5F3N2O2S
Molecular Weight 226.18 g/mol
SMILES C1=CC(=C(N=C1)S(=O)(=O)N)C(F)(F)F
InChIKey HGJUZHZBAAXGPP-UHFFFAOYSA-N
Last Updated: 2026-03-22 19:38

Related Q&A

Compound Q&A

How is 3-(Trifluoromethyl)pyridine-2-sulfonamide (CAS: 104040-76-8) typically synthesized?

3-(Trifluoromethyl)pyridine-2-sulfonamide is typically synthesized via the reaction of 3-(trifluorom...

Compound Q&A

What industries use 3-(Trifluoromethyl)pyridine-2-sulfonamide (CAS: 104040-76-8)?

3-(Trifluoromethyl)pyridine-2-sulfonamide is widely used in the pharmaceutical and chemical industri...

Compound Q&A

What precautions should be taken when handling 3-(Trifluoromethyl)pyridine-2-sulfonamide (CAS: 104040-76-8)?

When handling 3-(Trifluoromethyl)pyridine-2-sulfonamide, it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...