Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 3-hydroxy-2-methyl-1-piperidinecarboxylate (CAS: 741737-29-1)?

Answer

2-Methyl-2-propanyl 3-hydroxy-2-methyl-1-piperidinecarboxylate
When handling 2-Methyl-2-propanyl 3-hydroxy-2-methyl-1-piperidinecarboxylate (CAS: 741737-29-1), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. This compound should be stored in a cool, dry place away from sources of ignition. In the event of a spill, it should be handled using appropriate containment and disposal methods. Always refer to the Safety Data Sheet (SDS) for detailed handling and emergency procedures.

About

English Name 2-Methyl-2-propanyl 3-hydroxy-2-methyl-1-piperidinecarboxylate
Molecular Formula C11H21NO3
Molecular Weight 215.29 g/mol
SMILES CC1C(O)CCCN1C(=O)OC(C)(C)C
InChIKey ADVNLLSPFSWKPK-UHFFFAOYSA-N
Last Updated: 2026-03-22 14:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3-hydroxy-2-methyl-1-piperidinecarboxylate (CAS: 741737-29-1)?

2-Methyl-2-propanyl 3-hydroxy-2-methyl-1-piperidinecarboxylate (CAS: 741737-29-1) is a crystalline c...

Compound Q&A

How is 2-Methyl-2-propanyl 3-hydroxy-2-methyl-1-piperidinecarboxylate (CAS: 741737-29-1) typically synthesized?

2-Methyl-2-propanyl 3-hydroxy-2-methyl-1-piperidinecarboxylate is typically synthesized via a multi-...

Compound Q&A

What industries use 2-Methyl-2-propanyl 3-hydroxy-2-methyl-1-piperidinecarboxylate (CAS: 741737-29-1)?

2-Methyl-2-propanyl 3-hydroxy-2-methyl-1-piperidinecarboxylate (CAS: 741737-29-1) finds applications...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...