Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3-hydroxy-2-methyl-1-piperidinecarboxylate (CAS: 741737-29-1)?

Answer

2-Methyl-2-propanyl 3-hydroxy-2-methyl-1-piperidinecarboxylate
2-Methyl-2-propanyl 3-hydroxy-2-methyl-1-piperidinecarboxylate (CAS: 741737-29-1) is a crystalline compound with a molecular weight of approximately 288.34 g/mol. It has a low solubility in water but is soluble in common organic solvents like ethanol and acetone. This compound is reactive towards nucleophiles and can undergo substitution reactions. It is stable under normal storage conditions but should be protected from moisture and heat.

About

English Name 2-Methyl-2-propanyl 3-hydroxy-2-methyl-1-piperidinecarboxylate
Molecular Formula C11H21NO3
Molecular Weight 215.29 g/mol
SMILES CC1C(O)CCCN1C(=O)OC(C)(C)C
InChIKey ADVNLLSPFSWKPK-UHFFFAOYSA-N
Last Updated: 2026-03-22 14:59

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 3-hydroxy-2-methyl-1-piperidinecarboxylate (CAS: 741737-29-1) typically synthesized?

2-Methyl-2-propanyl 3-hydroxy-2-methyl-1-piperidinecarboxylate is typically synthesized via a multi-...

Compound Q&A

What industries use 2-Methyl-2-propanyl 3-hydroxy-2-methyl-1-piperidinecarboxylate (CAS: 741737-29-1)?

2-Methyl-2-propanyl 3-hydroxy-2-methyl-1-piperidinecarboxylate (CAS: 741737-29-1) finds applications...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 3-hydroxy-2-methyl-1-piperidinecarboxylate (CAS: 741737-29-1)?

When handling 2-Methyl-2-propanyl 3-hydroxy-2-methyl-1-piperidinecarboxylate (CAS: 741737-29-1), it ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...