Compound Q&A

What precautions should be taken when handling 5,7-Dimethoxy-3-methyl-1H-indazole (CAS: 154876-15-0)?

Answer

5,7-Dimethoxy-3-methyl-1H-indazole
When handling 5,7-Dimethoxy-3-methyl-1H-indazole (CAS: 154876-15-0), it is essential to use proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up using absorbent materials and disposed of according to local regulations. Always consult the Safety Data Sheet (SDS) for detailed handling and storage instructions. This compound is stable under normal conditions but should be stored in a cool, dry place away from direct heat sources.

About

English Name 5,7-Dimethoxy-3-methyl-1H-indazole
Molecular Formula C10H12N2O2
Molecular Weight 192.22 g/mol
SMILES CC1=C2C=C(C=C(C2=NN1)OC)OC
InChIKey SAEQJYKKYFAOJJ-UHFFFAOYSA-N
Last Updated: 2026-03-22 14:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5,7-Dimethoxy-3-methyl-1H-indazole (CAS: 154876-15-0)?

5,7-Dimethoxy-3-methyl-1H-indazole (CAS: 154876-15-0) is a crystalline solid with a molecular weight...

Compound Q&A

How is 5,7-Dimethoxy-3-methyl-1H-indazole (CAS: 154876-15-0) typically synthesized?

5,7-Dimethoxy-3-methyl-1H-indazole (CAS: 154876-15-0) can be synthesized via a multistep route invol...

Compound Q&A

What industries use 5,7-Dimethoxy-3-methyl-1H-indazole (CAS: 154876-15-0)?

5,7-Dimethoxy-3-methyl-1H-indazole (CAS: 154876-15-0) finds applications in pharmaceuticals, where i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...