Compound Q&A

What are the physical and chemical properties of 5,7-Dimethoxy-3-methyl-1H-indazole (CAS: 154876-15-0)?

Answer

5,7-Dimethoxy-3-methyl-1H-indazole
5,7-Dimethoxy-3-methyl-1H-indazole (CAS: 154876-15-0) is a crystalline solid with a molecular weight of approximately 212.2 g/mol. It has a low water solubility and is moderately soluble in common organic solvents like methanol and dichloromethane. Reactivity-wise, it is stable under normal conditions but can undergo substitution reactions in the presence of strong bases or acids. It is characterized by its unique UV-Vis absorption spectrum and is often used in organic synthesis and as a precursor in various chemical processes.

About

English Name 5,7-Dimethoxy-3-methyl-1H-indazole
Molecular Formula C10H12N2O2
Molecular Weight 192.22 g/mol
SMILES CC1=C2C=C(C=C(C2=NN1)OC)OC
InChIKey SAEQJYKKYFAOJJ-UHFFFAOYSA-N
Last Updated: 2026-03-22 14:59

Related Q&A

Compound Q&A

How is 5,7-Dimethoxy-3-methyl-1H-indazole (CAS: 154876-15-0) typically synthesized?

5,7-Dimethoxy-3-methyl-1H-indazole (CAS: 154876-15-0) can be synthesized via a multistep route invol...

Compound Q&A

What industries use 5,7-Dimethoxy-3-methyl-1H-indazole (CAS: 154876-15-0)?

5,7-Dimethoxy-3-methyl-1H-indazole (CAS: 154876-15-0) finds applications in pharmaceuticals, where i...

Compound Q&A

What precautions should be taken when handling 5,7-Dimethoxy-3-methyl-1H-indazole (CAS: 154876-15-0)?

When handling 5,7-Dimethoxy-3-methyl-1H-indazole (CAS: 154876-15-0), it is essential to use proper p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...