Compound Q&A

How should Dideoxykanamycin B (CAS: 34493-98-6) be stored?

Answer

Dideoxykanamycin B
Dideoxykanamycin B should be stored in a cool, dry place away from direct sunlight. It should be kept in a tightly closed container to maintain its stability and efficacy.

About

CAS No 34493-98-6
English Name Dideoxykanamycin B
Molecular Formula C18H37N5O8
Molecular Weight 451.52 g/mol
SMILES C1CC(C(OC1CN)OC2C(CC(C(C2O)OC3C(C(C(C(O3)CO)O)N)O)N)N)N
InChIKey JJCQSGDBDPYCEO-XVZSLQNASA-N
Last Updated: 2026-03-22 10:47

Related Q&A

Compound Q&A

What is Dideoxykanamycin B (CAS: 34493-98-6)?

Dideoxykanamycin B is an antibiotic compound with the CAS number 34493-98-6. It is a type of aminogl...

Compound Q&A

What are the main uses of Dideoxykanamycin B (CAS: 34493-98-6)?

Dideoxykanamycin B is primarily used as an antibiotic to treat various bacterial infections. It is a...

Compound Q&A

Is Dideoxykanamycin B (CAS: 34493-98-6) safe?

Dideoxykanamycin B can be safe when used under medical supervision. However, it may cause side effec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...