Compound Q&A

Is Dideoxykanamycin B (CAS: 34493-98-6) safe?

Answer

Dideoxykanamycin B
Dideoxykanamycin B can be safe when used under medical supervision. However, it may cause side effects such as nephrotoxicity and ototoxicity, so it is important to follow medical guidelines and precautions.

About

CAS No 34493-98-6
English Name Dideoxykanamycin B
Molecular Formula C18H37N5O8
Molecular Weight 451.52 g/mol
SMILES C1CC(C(OC1CN)OC2C(CC(C(C2O)OC3C(C(C(C(O3)CO)O)N)O)N)N)N
InChIKey JJCQSGDBDPYCEO-XVZSLQNASA-N
Last Updated: 2026-03-22 10:47

Related Q&A

Compound Q&A

What is Dideoxykanamycin B (CAS: 34493-98-6)?

Dideoxykanamycin B is an antibiotic compound with the CAS number 34493-98-6. It is a type of aminogl...

Compound Q&A

What are the main uses of Dideoxykanamycin B (CAS: 34493-98-6)?

Dideoxykanamycin B is primarily used as an antibiotic to treat various bacterial infections. It is a...

Compound Q&A

How should Dideoxykanamycin B (CAS: 34493-98-6) be stored?

Dideoxykanamycin B should be stored in a cool, dry place away from direct sunlight. It should be kep...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...