Compound Q&A

How should 4-(4-Bromophenyl)-4-piperidinecarboxylic acid (CAS: 913542-80-0) be stored?

Answer

4-(4-Bromophenyl)-4-piperidinecarboxylic acid
4-(4-Bromophenyl)-4-piperidinecarboxylic acid (CAS: 913542-80-0) should be stored in a cool, dry place, protected from light and moisture. It should be kept in a sealed container to prevent degradation. The temperature should be maintained below 25°C to ensure optimal stability and safety.

About

English Name 4-(4-Bromophenyl)-4-piperidinecarboxylic acid
Molecular Formula C12H14BrNO2
Molecular Weight 284.15 g/mol
SMILES OC(=O)C1(CCNCC1)c2ccc(Br)cc2
InChIKey NVDSELFOZXBDOZ-UHFFFAOYSA-N
Last Updated: 2026-03-22 00:15

Related Q&A

Compound Q&A

What is 4-(4-Bromophenyl)-4-piperidinecarboxylic acid (CAS: 913542-80-0)?

4-(4-Bromophenyl)-4-piperidinecarboxylic acid (CAS: 913542-80-0) is a chemical compound with a molec...

Compound Q&A

What are the main uses of 4-(4-Bromophenyl)-4-piperidinecarboxylic acid (CAS: 913542-80-0)?

4-(4-Bromophenyl)-4-piperidinecarboxylic acid (CAS: 913542-80-0) is mainly used in pharmaceutical re...

Compound Q&A

Is 4-(4-Bromophenyl)-4-piperidinecarboxylic acid (CAS: 913542-80-0) safe?

4-(4-Bromophenyl)-4-piperidinecarboxylic acid (CAS: 913542-80-0) is generally safe when used under p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...