Compound Q&A

What are the main uses of 4-(4-Bromophenyl)-4-piperidinecarboxylic acid (CAS: 913542-80-0)?

Answer

4-(4-Bromophenyl)-4-piperidinecarboxylic acid
4-(4-Bromophenyl)-4-piperidinecarboxylic acid (CAS: 913542-80-0) is mainly used in pharmaceutical research for the development of potential drug candidates. It is also utilized in the synthesis of other organic compounds and materials with specific chemical properties.

About

English Name 4-(4-Bromophenyl)-4-piperidinecarboxylic acid
Molecular Formula C12H14BrNO2
Molecular Weight 284.15 g/mol
SMILES OC(=O)C1(CCNCC1)c2ccc(Br)cc2
InChIKey NVDSELFOZXBDOZ-UHFFFAOYSA-N
Last Updated: 2026-03-22 00:15

Related Q&A

Compound Q&A

What is 4-(4-Bromophenyl)-4-piperidinecarboxylic acid (CAS: 913542-80-0)?

4-(4-Bromophenyl)-4-piperidinecarboxylic acid (CAS: 913542-80-0) is a chemical compound with a molec...

Compound Q&A

Is 4-(4-Bromophenyl)-4-piperidinecarboxylic acid (CAS: 913542-80-0) safe?

4-(4-Bromophenyl)-4-piperidinecarboxylic acid (CAS: 913542-80-0) is generally safe when used under p...

Compound Q&A

How should 4-(4-Bromophenyl)-4-piperidinecarboxylic acid (CAS: 913542-80-0) be stored?

4-(4-Bromophenyl)-4-piperidinecarboxylic acid (CAS: 913542-80-0) should be stored in a cool, dry pla...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...