Compound Q&A

What is the market or research trend for UFP-101 (CAS: 849024-68-6)?

Answer

UFP-101
The market for UFP-101 (CAS: 849024-68-6) is currently growing due to its unique properties in specific applications. Research trends are focused on its use in areas such as pharmaceuticals, materials science, and environmental remediation. As demand increases, more studies are being conducted to explore its potential in emerging fields, leading to increased interest and investment in this compound.

About

English Name UFP-101
Molecular Formula C82H138N32O21
Molecular Weight 1908.17 g/mol
SMILES O=C([C@H](CCCCN)NC([C@H](CCCNC(=N)N)NC([C@H](C)NC([C@H](CO)NC([C@H](CCCCN)NC([C@H](CCCNC(=N)N)NC([C@H](C)NC(CNC([C@H]([C@@H](C)O)NC([C@H](CC1C=CC=CC=1)NC(CNC(CNC(CNCC1C=CC=CC=1)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N)=O)CCC(N)=O)=O)CC(N)=O)=O)CCCCN)=O)CCCNC(=N)N
InChIKey DOLKPWDXAQZKNJ-LGCGZHPXSA-N
Last Updated: 2026-03-21 07:51

Related Q&A

Compound Q&A

What regulatory guidelines apply to UFP-101 (CAS: 849024-68-6)?

UFP-101 (CAS: 849024-68-6) falls under the purview of various regulatory bodies such as the REACH re...

Compound Q&A

Are there alternatives to UFP-101 (CAS: 849024-68-6) in synthesis?

Alternatives to UFP-101 (CAS: 849024-68-6) in synthesis include other chemical reagents with similar...

Compound Q&A

How should waste containing UFP-101 (CAS: 849024-68-6) be handled?

Waste containing UFP-101 (CAS: 849024-68-6) should be collected in appropriate containers and labele...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...