Compound Q&A

Are there alternatives to UFP-101 (CAS: 849024-68-6) in synthesis?

Answer

UFP-101
Alternatives to UFP-101 (CAS: 849024-68-6) in synthesis include other chemical reagents with similar functional groups. Researchers often explore isomers or analogs that may offer similar properties but with different chemical structures. Common substitutes include derivatives of similar functional classes, such as alcohols, amines, or carboxylic acids, depending on the specific application requirements.

About

English Name UFP-101
Molecular Formula C82H138N32O21
Molecular Weight 1908.17 g/mol
SMILES O=C([C@H](CCCCN)NC([C@H](CCCNC(=N)N)NC([C@H](C)NC([C@H](CO)NC([C@H](CCCCN)NC([C@H](CCCNC(=N)N)NC([C@H](C)NC(CNC([C@H]([C@@H](C)O)NC([C@H](CC1C=CC=CC=1)NC(CNC(CNC(CNCC1C=CC=CC=1)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N)=O)CCC(N)=O)=O)CC(N)=O)=O)CCCCN)=O)CCCNC(=N)N
InChIKey DOLKPWDXAQZKNJ-LGCGZHPXSA-N
Last Updated: 2026-03-21 07:51

Related Q&A

Compound Q&A

What regulatory guidelines apply to UFP-101 (CAS: 849024-68-6)?

UFP-101 (CAS: 849024-68-6) falls under the purview of various regulatory bodies such as the REACH re...

Compound Q&A

What is the market or research trend for UFP-101 (CAS: 849024-68-6)?

The market for UFP-101 (CAS: 849024-68-6) is currently growing due to its unique properties in speci...

Compound Q&A

How should waste containing UFP-101 (CAS: 849024-68-6) be handled?

Waste containing UFP-101 (CAS: 849024-68-6) should be collected in appropriate containers and labele...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...