Compound Q&A

What industries use 1-(9H-Fluoren-9-yl)-3,11-dioxo-2,7-dioxa-4,10-diazatetradecan-14-oic acid (CAS: 669073-62-5)?

Answer

1-(9H-Fluoren-9-yl)-3,11-dioxo-2,7-dioxa-4,10-diazatetradecan-14-oic acid
1-(9H-Fluoren-9-yl)-3,11-dioxo-2,7-dioxa-4,10-diazatetradecan-14-oic acid finds applications in pharmaceuticals, where it serves as a building block for complex molecules. It is also used in the synthesis of polymers for biomedical applications and in the development of sensors due to its unique chemical properties. Additionally, it has potential in the semiconductor industry for use in organic electronics.

About

English Name 1-(9H-Fluoren-9-yl)-3,11-dioxo-2,7-dioxa-4,10-diazatetradecan-14-oic acid
Molecular Formula C23H26N2O6
Molecular Weight 426.47 g/mol
SMILES C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCNC(=O)CCC(=O)O
InChIKey ZZKFTNFZZHGPGO-UHFFFAOYSA-N
Last Updated: 2026-03-20 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(9H-Fluoren-9-yl)-3,11-dioxo-2,7-dioxa-4,10-diazatetradecan-14-oic acid (CAS: 669073-62-5)?

1-(9H-Fluoren-9-yl)-3,11-dioxo-2,7-dioxa-4,10-diazatetradecan-14-oic acid is a crystalline compound ...

Compound Q&A

How is 1-(9H-Fluoren-9-yl)-3,11-dioxo-2,7-dioxa-4,10-diazatetradecan-14-oic acid (CAS: 669073-62-5) typically synthesized?

1-(9H-Fluoren-9-yl)-3,11-dioxo-2,7-dioxa-4,10-diazatetradecan-14-oic acid is synthesized via a multi...

Compound Q&A

What precautions should be taken when handling 1-(9H-Fluoren-9-yl)-3,11-dioxo-2,7-dioxa-4,10-diazatetradecan-14-oic acid (CAS: 669073-62-5)?

When handling 1-(9H-Fluoren-9-yl)-3,11-dioxo-2,7-dioxa-4,10-diazatetradecan-14-oic acid, it is essen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...