Compound Q&A

What industries use 2,2-diphenylacetamide (CAS: 4695-13-0)?

Answer

2,2-diphenylacetamide
2,2-Diphenylacetamide (CAS: 4695-13-0) is used in various industries, including pharmaceuticals for its use as an intermediate in the synthesis of certain drugs, polymers for its role in the formation of certain plastic materials, and sensors for its application in the detection of specific chemicals. It is also utilized in the semiconductor industry for its properties in certain doping applications.

About

CAS No 4695-13-0
English Name 2,2-diphenylacetamide
Molecular Formula C14H13NO
Molecular Weight 211.26 g/mol
SMILES C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)N
InChIKey ZXQVXEAZKZFEEP-UHFFFAOYSA-N
Last Updated: 2026-03-20 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2-diphenylacetamide (CAS: 4695-13-0)?

2,2-Diphenylacetamide (CAS: 4695-13-0) is a white crystalline solid with a molecular weight of appro...

Compound Q&A

How is 2,2-diphenylacetamide (CAS: 4695-13-0) typically synthesized?

2,2-Diphenylacetamide is typically synthesized by the amidation of acetic anhydride with diphenylami...

Compound Q&A

What precautions should be taken when handling 2,2-diphenylacetamide (CAS: 4695-13-0)?

When handling 2,2-diphenylacetamide (CAS: 4695-13-0), it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...