Compound Q&A

How is Adefovir Dipivoxil Impurity 1 (CAS: 1215101-40-8) typically synthesized?

Answer

Adefovir Dipivoxil Impurity 1
Adefovir Dipivoxil Impurity 1 is synthesized through a series of chemical reactions, primarily involving the acylation of a nucleoside derivative. Commonly, this involves the use of dipivaloyl chloride as the acylating agent. The synthesis typically requires careful control of reaction conditions to achieve high selectivity and yield. The process involves multiple steps, including purification and crystallization, to obtain the desired impurity.

About

English Name Adefovir Dipivoxil Impurity 1
Molecular Formula C25H40N5O9P
Molecular Weight 585.6 g/mol
SMILES CC(C)(C)C(=O)Nc1c2c(ncn1)n(cn2)CCOCP(=O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C
InChIKey APRPNPWRQHFUDM-UHFFFAOYSA-N
Last Updated: 2026-03-20 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Adefovir Dipivoxil Impurity 1 (CAS: 1215101-40-8)?

Adefovir Dipivoxil Impurity 1 is a solid with a crystalline form. Its molecular weight is approximat...

Compound Q&A

What industries use Adefovir Dipivoxil Impurity 1 (CAS: 1215101-40-8)?

Adefovir Dipivoxil Impurity 1 (CAS: 1215101-40-8) is primarily used in the pharmaceutical industry, ...

Compound Q&A

What precautions should be taken when handling Adefovir Dipivoxil Impurity 1 (CAS: 1215101-40-8)?

When handling Adefovir Dipivoxil Impurity 1 (CAS: 1215101-40-8), it is essential to use appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...