Compound Q&A

What are the physical and chemical properties of Adefovir Dipivoxil Impurity 1 (CAS: 1215101-40-8)?

Answer

Adefovir Dipivoxil Impurity 1
Adefovir Dipivoxil Impurity 1 is a solid with a crystalline form. Its molecular weight is approximately 405.5 g/mol. This impurity is poorly soluble in water but soluble in organic solvents like dimethyl sulfoxide (DMSO). It is relatively stable under normal conditions but may react with strong acids or bases. The impurity is generally not reactive towards common functional groups under normal laboratory conditions.

About

English Name Adefovir Dipivoxil Impurity 1
Molecular Formula C25H40N5O9P
Molecular Weight 585.6 g/mol
SMILES CC(C)(C)C(=O)Nc1c2c(ncn1)n(cn2)CCOCP(=O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C
InChIKey APRPNPWRQHFUDM-UHFFFAOYSA-N
Last Updated: 2026-03-20 10:59

Related Q&A

Compound Q&A

How is Adefovir Dipivoxil Impurity 1 (CAS: 1215101-40-8) typically synthesized?

Adefovir Dipivoxil Impurity 1 is synthesized through a series of chemical reactions, primarily invol...

Compound Q&A

What industries use Adefovir Dipivoxil Impurity 1 (CAS: 1215101-40-8)?

Adefovir Dipivoxil Impurity 1 (CAS: 1215101-40-8) is primarily used in the pharmaceutical industry, ...

Compound Q&A

What precautions should be taken when handling Adefovir Dipivoxil Impurity 1 (CAS: 1215101-40-8)?

When handling Adefovir Dipivoxil Impurity 1 (CAS: 1215101-40-8), it is essential to use appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...