Compound Q&A

What industries use N,N,N-Trimethylmethanaminium 2-carboxybenzoate (CAS: 79723-02-7)?

Answer

N,N,N-Trimethylmethanaminium 2-carboxybenzoate
N,N,N-Trimethylmethanaminium 2-carboxybenzoate finds applications in various industries. It is used in pharmaceuticals for the synthesis of certain drugs, in polymers as a plasticizer, in sensors for detection of specific chemicals, and in semiconductors as a dopant. Additionally, it has potential uses in the cosmetic and food industries.

About

CAS No 79723-02-7
English Name N,N,N-Trimethylmethanaminium 2-carboxybenzoate
Molecular Formula C12H17NO4
Molecular Weight 239.27 g/mol
SMILES C[N+](C)(C)C.C1=CC=C(C(=C1)C(=O)O)C(=O)[O-]
InChIKey KQTFRASJMFIJPC-UHFFFAOYSA-M
Last Updated: 2026-03-20 06:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N,N-Trimethylmethanaminium 2-carboxybenzoate (CAS: 79723-02-7)?

N,N,N-Trimethylmethanaminium 2-carboxybenzoate is a white or colorless crystalline solid with a mole...

Compound Q&A

How is N,N,N-Trimethylmethanaminium 2-carboxybenzoate (CAS: 79723-02-7) typically synthesized?

N,N,N-Trimethylmethanaminium 2-carboxybenzoate is typically synthesized by the reaction of 2-carboxy...

Compound Q&A

What precautions should be taken when handling N,N,N-Trimethylmethanaminium 2-carboxybenzoate (CAS: 79723-02-7)?

When handling N,N,N-Trimethylmethanaminium 2-carboxybenzoate, use appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...