Compound Q&A

How is N,N,N-Trimethylmethanaminium 2-carboxybenzoate (CAS: 79723-02-7) typically synthesized?

Answer

N,N,N-Trimethylmethanaminium 2-carboxybenzoate
N,N,N-Trimethylmethanaminium 2-carboxybenzoate is typically synthesized by the reaction of 2-carboxybenzoic acid with trimethylamine under mild acidic conditions. The process involves the formation of an intermediate salt which is then treated with methanesulfonic acid to form the final product. The yield is usually around 80%, and the reaction is highly selective.

About

CAS No 79723-02-7
English Name N,N,N-Trimethylmethanaminium 2-carboxybenzoate
Molecular Formula C12H17NO4
Molecular Weight 239.27 g/mol
SMILES C[N+](C)(C)C.C1=CC=C(C(=C1)C(=O)O)C(=O)[O-]
InChIKey KQTFRASJMFIJPC-UHFFFAOYSA-M
Last Updated: 2026-03-20 06:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N,N-Trimethylmethanaminium 2-carboxybenzoate (CAS: 79723-02-7)?

N,N,N-Trimethylmethanaminium 2-carboxybenzoate is a white or colorless crystalline solid with a mole...

Compound Q&A

What industries use N,N,N-Trimethylmethanaminium 2-carboxybenzoate (CAS: 79723-02-7)?

N,N,N-Trimethylmethanaminium 2-carboxybenzoate finds applications in various industries. It is used ...

Compound Q&A

What precautions should be taken when handling N,N,N-Trimethylmethanaminium 2-carboxybenzoate (CAS: 79723-02-7)?

When handling N,N,N-Trimethylmethanaminium 2-carboxybenzoate, use appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...