Compound Q&A

What industries use Ethyl 3,5-diiodo-L-tyrosinate hydrochloride (CAS: 74051-47-1)?

Answer

Ethyl 3,5-diiodo-L-tyrosinate hydrochloride (1:1)
Ethyl 3,5-diiodo-L-tyrosinate hydrochloride (CAS: 74051-47-1) is used in the pharmaceutical industry for the development of iodinated tyrosine analogs. It is also utilized in the preparation of sensing materials and as a reagent in organic synthesis. Additionally, it may have applications in polymer chemistry and semiconductor manufacturing, though its use in these areas is less common.

About

CAS No 74051-47-1
English Name Ethyl 3,5-diiodo-L-tyrosinate hydrochloride (1:1)
Molecular Formula C11H14ClI2NO3
Molecular Weight 497.5 g/mol
SMILES CCOC(=O)C(CC1=CC(=C(C(=C1)I)O)I)N.Cl
InChIKey ILBBOCVXEPIPBR-FVGYRXGTSA-N
Last Updated: 2026-03-20 06:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 3,5-diiodo-L-tyrosinate hydrochloride (CAS: 74051-47-1)?

Ethyl 3,5-diiodo-L-tyrosinate hydrochloride (CAS: 74051-47-1) is a crystalline compound with a molec...

Compound Q&A

How is Ethyl 3,5-diiodo-L-tyrosinate hydrochloride (CAS: 74051-47-1) typically synthesized?

Ethyl 3,5-diiodo-L-tyrosinate hydrochloride (CAS: 74051-47-1) is synthesized by reacting 3,5-diiodo-...

Compound Q&A

What precautions should be taken when handling Ethyl 3,5-diiodo-L-tyrosinate hydrochloride (CAS: 74051-47-1)?

When handling Ethyl 3,5-diiodo-L-tyrosinate hydrochloride (CAS: 74051-47-1), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...