Compound Q&A

How is 3-(Benzyloxy)picolinic acid (CAS: 117529-29-2) typically synthesized?

Answer

3-(Benzyloxy)picolinic acid
3-(Benzyloxy)picolinic acid is typically synthesized via the reaction of benzyloxyamine with picolinic acid. The synthesis involves mild heating and can be performed under acidic or basic conditions. The yield is generally around 80-85%, and the reaction is selective with good purity achievable through recrystallization.

About

English Name 3-(Benzyloxy)picolinic acid
Molecular Formula C13H11NO3
Molecular Weight 229.23 g/mol
SMILES C1=CC=C(C=C1)COC2=C(N=CC=C2)C(=O)O
InChIKey MWHFMAMJIYHCLW-UHFFFAOYSA-N
Last Updated: 2026-03-20 02:47

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(Benzyloxy)picolinic acid (CAS: 117523-29-2)?

3-(Benzyloxy)picolinic acid (CAS: 117523-29-2) is a white crystalline solid with a molecular weight ...

Compound Q&A

What industries use 3-(Benzyloxy)picolinic acid (CAS: 117523-29-2)?

3-(Benzyloxy)picolinic acid (CAS: 117523-29-2) is used in pharmaceuticals for its potential as a dru...

Compound Q&A

What precautions should be taken when handling 3-(Benzyloxy)picolinic acid (CAS: 117523-29-2)?

When handling 3-(Benzyloxy)picolinic acid (CAS: 117523-29-2), it is recommended to use appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...