Compound Q&A

What are the physical and chemical properties of 3-(Benzyloxy)picolinic acid (CAS: 117523-29-2)?

Answer

3-(Benzyloxy)picolinic acid
3-(Benzyloxy)picolinic acid (CAS: 117523-29-2) is a white crystalline solid with a molecular weight of approximately 224.23 g/mol. It has a solubility of about 0.7 g/100 mL in water. The compound is mildly reactive towards bases, showing some hydrolytic instability. It is stable under normal storage conditions but should be protected from moisture and light.

About

English Name 3-(Benzyloxy)picolinic acid
Molecular Formula C13H11NO3
Molecular Weight 229.23 g/mol
SMILES C1=CC=C(C=C1)COC2=C(N=CC=C2)C(=O)O
InChIKey MWHFMAMJIYHCLW-UHFFFAOYSA-N
Last Updated: 2026-03-20 02:47

Related Q&A

Compound Q&A

How is 3-(Benzyloxy)picolinic acid (CAS: 117529-29-2) typically synthesized?

3-(Benzyloxy)picolinic acid is typically synthesized via the reaction of benzyloxyamine with picolin...

Compound Q&A

What industries use 3-(Benzyloxy)picolinic acid (CAS: 117523-29-2)?

3-(Benzyloxy)picolinic acid (CAS: 117523-29-2) is used in pharmaceuticals for its potential as a dru...

Compound Q&A

What precautions should be taken when handling 3-(Benzyloxy)picolinic acid (CAS: 117523-29-2)?

When handling 3-(Benzyloxy)picolinic acid (CAS: 117523-29-2), it is recommended to use appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...