Compound Q&A

How is 2-Methyl-2-propanyl 5-amino-2,3,4,5-tetrahydro-1H-1-benzazepine-1-carboxylate (CAS: 811841-95-9) typically synthesized?

Answer

2-Methyl-2-propanyl 5-amino-2,3,4,5-tetrahydro-1H-1-benzazepine-1-carboxylate
This compound is often synthesized via amidation of 2-Methyl-2-propanyl 5-aminocarbonyl-2,3,4,5-tetrahydro-1H-1-benzazepine with an appropriate carboxylic acid chloride in the presence of a base like diisopropylethylamine. The reaction is typically carried out in anhydrous conditions to minimize side reactions.

About

English Name 2-Methyl-2-propanyl 5-amino-2,3,4,5-tetrahydro-1H-1-benzazepine-1-carboxylate
Molecular Formula C15H22N2O2
Molecular Weight 262.35 g/mol
SMILES CC(C)(C)OC(=O)N1CCCC(C2=CC=CC=C21)N
InChIKey ZSFIRJQRHJSLSZ-UHFFFAOYSA-N
Last Updated: 2026-03-19 20:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 5-amino-2,3,4,5-tetrahydro-1H-1-benzazepine-1-carboxylate (CAS: 811841-95-9)?

This compound is a crystalline solid with a molecular weight of approximately 312.4 g/mol. It has a ...

Compound Q&A

What industries use 2-Methyl-2-propanyl 5-amino-2,3,4,5-tetrahydro-1H-1-benzazepine-1-carboxylate (CAS: 811841-95-9)?

This compound is primarily used in the pharmaceutical industry, particularly in the development of c...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 5-amino-2,3,4,5-tetrahydro-1H-1-benzazepine-1-carboxylate (CAS: 811841-95-9)?

When handling this compound, appropriate personal protective equipment (PPE) such as gloves, goggles...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...