Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 5-amino-2,3,4,5-tetrahydro-1H-1-benzazepine-1-carboxylate (CAS: 811841-95-9)?

Answer

2-Methyl-2-propanyl 5-amino-2,3,4,5-tetrahydro-1H-1-benzazepine-1-carboxylate
This compound is a crystalline solid with a molecular weight of approximately 312.4 g/mol. It has a low water solubility and high solubility in organic solvents. Chemically, it is relatively stable but can react with strong acids or bases. It is slightly basic due to the amino group.

About

English Name 2-Methyl-2-propanyl 5-amino-2,3,4,5-tetrahydro-1H-1-benzazepine-1-carboxylate
Molecular Formula C15H22N2O2
Molecular Weight 262.35 g/mol
SMILES CC(C)(C)OC(=O)N1CCCC(C2=CC=CC=C21)N
InChIKey ZSFIRJQRHJSLSZ-UHFFFAOYSA-N
Last Updated: 2026-03-19 20:21

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 5-amino-2,3,4,5-tetrahydro-1H-1-benzazepine-1-carboxylate (CAS: 811841-95-9) typically synthesized?

This compound is often synthesized via amidation of 2-Methyl-2-propanyl 5-aminocarbonyl-2,3,4,5-tetr...

Compound Q&A

What industries use 2-Methyl-2-propanyl 5-amino-2,3,4,5-tetrahydro-1H-1-benzazepine-1-carboxylate (CAS: 811841-95-9)?

This compound is primarily used in the pharmaceutical industry, particularly in the development of c...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 5-amino-2,3,4,5-tetrahydro-1H-1-benzazepine-1-carboxylate (CAS: 811841-95-9)?

When handling this compound, appropriate personal protective equipment (PPE) such as gloves, goggles...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...