Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-[(2-pyridinylsulfanyl)methyl]-1-piperidinecarboxylate (CAS: 745066-46-0)?

Answer

2-Methyl-2-propanyl 4-[(2-pyridinylsulfanyl)methyl]-1-piperidinecarboxylate
Proper handling of 2-Methyl-2-propanyl 4-[(2-pyridinylsulfanyl)methyl]-1-piperidinecarboxylate requires the use of appropriate personal protective equipment (PPE), including gloves, safety glasses, and a lab coat. It should be stored in a cool, dry place away from direct sunlight and heat sources. Spills should be cleaned up using appropriate laboratory procedures and the material safety data sheet (MSDS) should be consulted for specific instructions. Handling this compound should be done in a well-ventilated area or a fume hood to minimize exposure to fumes.

About

English Name 2-Methyl-2-propanyl 4-[(2-pyridinylsulfanyl)methyl]-1-piperidinecarboxylate
Molecular Formula C16H24N2O2S
Molecular Weight 308.45 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(CC1)CSc2ccccn2
InChIKey NGZPZDSBKOJWPT-UHFFFAOYSA-N
Last Updated: 2026-03-19 20:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-[(2-pyridinylsulfanyl)methyl]-1-piperidinecarboxylate (CAS: 745066-46-0)?

2-Methyl-2-propanyl 4-[(2-pyridinylsulfanyl)methyl]-1-piperidinecarboxylate is a crystalline compoun...

Compound Q&A

How is 2-Methyl-2-propanyl 4-[(2-pyridinylsulfanyl)methyl]-1-piperidinecarboxylate (CAS: 745066-46-0) typically synthesized?

2-Methyl-2-propanyl 4-[(2-pyridinylsulfanyl)methyl]-1-piperidinecarboxylate is typically synthesized...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-[(2-pyridinylsulfanyl)methyl]-1-piperidinecarboxylate (CAS: 745066-46-0)?

2-Methyl-2-propanyl 4-[(2-pyridinylsulfanyl)methyl]-1-piperidinecarboxylate is primarily used in the...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...