Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-[(2-pyridinylsulfanyl)methyl]-1-piperidinecarboxylate (CAS: 745066-46-0)?

Answer

2-Methyl-2-propanyl 4-[(2-pyridinylsulfanyl)methyl]-1-piperidinecarboxylate
2-Methyl-2-propanyl 4-[(2-pyridinylsulfanyl)methyl]-1-piperidinecarboxylate is a crystalline compound with a high melting point. The molecular weight is approximately 335 g/mol. It has limited solubility in water but is soluble in common organic solvents. The compound is relatively stable but may react with strong acids or bases. It is used in pharmaceutical applications and has a pKa of about 5.5.

About

English Name 2-Methyl-2-propanyl 4-[(2-pyridinylsulfanyl)methyl]-1-piperidinecarboxylate
Molecular Formula C16H24N2O2S
Molecular Weight 308.45 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(CC1)CSc2ccccn2
InChIKey NGZPZDSBKOJWPT-UHFFFAOYSA-N
Last Updated: 2026-03-19 20:21

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 4-[(2-pyridinylsulfanyl)methyl]-1-piperidinecarboxylate (CAS: 745066-46-0) typically synthesized?

2-Methyl-2-propanyl 4-[(2-pyridinylsulfanyl)methyl]-1-piperidinecarboxylate is typically synthesized...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-[(2-pyridinylsulfanyl)methyl]-1-piperidinecarboxylate (CAS: 745066-46-0)?

2-Methyl-2-propanyl 4-[(2-pyridinylsulfanyl)methyl]-1-piperidinecarboxylate is primarily used in the...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-[(2-pyridinylsulfanyl)methyl]-1-piperidinecarboxylate (CAS: 745066-46-0)?

Proper handling of 2-Methyl-2-propanyl 4-[(2-pyridinylsulfanyl)methyl]-1-piperidinecarboxylate requi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...