Compound Q&A

What industries use Ethyl 4-(2-methoxyphenyl)-3-oxobutanoate (CAS: 83823-61-4)?

Answer

Ethyl 4-(2-methoxyphenyl)-3-oxobutanoate
Ethyl 4-(2-methoxyphenyl)-3-oxobutanoate (CAS: 83823-61-4) is used in the pharmaceutical industry for the synthesis of certain drug intermediates. It is also utilized in the polymer industry for specific monomer applications and in sensor technology for its reactivity and stability. Additionally, it has potential applications in semiconductor manufacturing for certain chemical processes.

About

CAS No 83823-61-4
English Name Ethyl 4-(2-methoxyphenyl)-3-oxobutanoate
Molecular Formula C13H16O4
Molecular Weight 236.27 g/mol
SMILES CCOC(=O)CC(=O)CC1=CC=CC=C1OC
InChIKey UTHZUODGIWFCOP-UHFFFAOYSA-N
Last Updated: 2026-03-19 14:17

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 4-(2-methoxyphenyl)-3-oxobutanoate (CAS: 83823-61-4)?

Ethyl 4-(2-methoxyphenyl)-3-oxobutanoate (CAS: 83823-61-4) is a crystalline compound with a molecula...

Compound Q&A

How is Ethyl 4-(2-methoxyphenyl)-3-oxobutanoate (CAS: 83823-61-4) typically synthesized?

Ethyl 4-(2-methoxyphenyl)-3-oxobutanoate (CAS: 83823-61-4) is typically synthesized via esterificati...

Compound Q&A

What precautions should be taken when handling Ethyl 4-(2-methoxyphenyl)-3-oxobutanoate (CAS: 83823-61-4)?

When handling Ethyl 4-(2-methoxyphenyl)-3-oxobutanoate (CAS: 83823-61-4), appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...