Compound Q&A

How is Ethyl 4-(2-methoxyphenyl)-3-oxobutanoate (CAS: 83823-61-4) typically synthesized?

Answer

Ethyl 4-(2-methoxyphenyl)-3-oxobutanoate
Ethyl 4-(2-methoxyphenyl)-3-oxobutanoate (CAS: 83823-61-4) is typically synthesized via esterification of 2-methoxybenzaldehyde with ethyl acetoacetate in the presence of an acid catalyst. The reaction is carried out under reflux conditions, and the product undergoes a high degree of selectivity with good yield. This method ensures the formation of the desired product with minimal side products.

About

CAS No 83823-61-4
English Name Ethyl 4-(2-methoxyphenyl)-3-oxobutanoate
Molecular Formula C13H16O4
Molecular Weight 236.27 g/mol
SMILES CCOC(=O)CC(=O)CC1=CC=CC=C1OC
InChIKey UTHZUODGIWFCOP-UHFFFAOYSA-N
Last Updated: 2026-03-19 14:17

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 4-(2-methoxyphenyl)-3-oxobutanoate (CAS: 83823-61-4)?

Ethyl 4-(2-methoxyphenyl)-3-oxobutanoate (CAS: 83823-61-4) is a crystalline compound with a molecula...

Compound Q&A

What industries use Ethyl 4-(2-methoxyphenyl)-3-oxobutanoate (CAS: 83823-61-4)?

Ethyl 4-(2-methoxyphenyl)-3-oxobutanoate (CAS: 83823-61-4) is used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling Ethyl 4-(2-methoxyphenyl)-3-oxobutanoate (CAS: 83823-61-4)?

When handling Ethyl 4-(2-methoxyphenyl)-3-oxobutanoate (CAS: 83823-61-4), appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...