Compound Q&A

What precautions should be taken when handling 1-Ethyl-1H-benzimidazole-2-sulfonic acid (CAS: 90331-19-4)?

Answer

1-Ethyl-1H-benzimidazole-2-sulfonic acid
When handling 1-Ethyl-1H-benzimidazole-2-sulfonic acid (CAS: 90331-19-4), it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a well-ventilated area or a fume hood to avoid inhalation of any vapor. In case of a spill, neutralize the acid with a base and collect the waste according to local regulations. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal information.

About

CAS No 90331-19-4
English Name 1-Ethyl-1H-benzimidazole-2-sulfonic acid
Molecular Formula C9H10N2O3S
Molecular Weight 226.26 g/mol
SMILES CCN1C2=CC=CC=C2N=C1S(=O)(=O)O
InChIKey CPFYRNMZRZTXRQ-UHFFFAOYSA-N
Last Updated: 2026-03-19 14:17

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Ethyl-1H-benzimidazole-2-sulfonic acid (CAS: 90331-19-4)?

1-Ethyl-1H-benzimidazole-2-sulfonic acid (CAS: 90331-19-4) is a crystalline solid with a molecular w...

Compound Q&A

How is 1-Ethyl-1H-benzimidazole-2-sulfonic acid (CAS: 90331-19-4) typically synthesized?

1-Ethyl-1H-benzimidazole-2-sulfonic acid is typically synthesized by the reaction of 1-ethylbenzimid...

Compound Q&A

What industries use 1-Ethyl-1H-benzimidazole-2-sulfonic acid (CAS: 90331-19-4)?

1-Ethyl-1H-benzimidazole-2-sulfonic acid (CAS: 90331-19-4) is primarily used in the pharmaceutical i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...