Compound Q&A

What industries use 1-Ethyl-1H-benzimidazole-2-sulfonic acid (CAS: 90331-19-4)?

Answer

1-Ethyl-1H-benzimidazole-2-sulfonic acid
1-Ethyl-1H-benzimidazole-2-sulfonic acid (CAS: 90331-19-4) is primarily used in the pharmaceutical industry for the synthesis of various drugs and in the sensor industry for developing pH sensors and other electrochemical sensors. It is also utilized in the polymer industry for certain types of functional polymers.

About

CAS No 90331-19-4
English Name 1-Ethyl-1H-benzimidazole-2-sulfonic acid
Molecular Formula C9H10N2O3S
Molecular Weight 226.26 g/mol
SMILES CCN1C2=CC=CC=C2N=C1S(=O)(=O)O
InChIKey CPFYRNMZRZTXRQ-UHFFFAOYSA-N
Last Updated: 2026-03-19 14:17

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Ethyl-1H-benzimidazole-2-sulfonic acid (CAS: 90331-19-4)?

1-Ethyl-1H-benzimidazole-2-sulfonic acid (CAS: 90331-19-4) is a crystalline solid with a molecular w...

Compound Q&A

How is 1-Ethyl-1H-benzimidazole-2-sulfonic acid (CAS: 90331-19-4) typically synthesized?

1-Ethyl-1H-benzimidazole-2-sulfonic acid is typically synthesized by the reaction of 1-ethylbenzimid...

Compound Q&A

What precautions should be taken when handling 1-Ethyl-1H-benzimidazole-2-sulfonic acid (CAS: 90331-19-4)?

When handling 1-Ethyl-1H-benzimidazole-2-sulfonic acid (CAS: 90331-19-4), it is essential to use per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...