Compound Q&A

What are the physical and chemical properties of 3-(Di-2-thienylmethylene)-5-methoxy-1,1-dimethylpiperidinium bromide (CAS: 35035-05-3)?

Answer

3-(Di-2-thienylmethylene)-5-methoxy-1,1-dimethylpiperidinium bromide
3-(Di-2-thienylmethylene)-5-methoxy-1,1-dimethylpiperidinium bromide is a crystalline solid with a molecular weight of approximately 449.41 g/mol. It has a solubility of about 20 mg/mL in water and is slightly soluble in common organic solvents. The compound is moderately reactive, particularly with nucleophiles. It is stable under normal conditions but should be stored away from moisture and strong acids.

About

CAS No 35035-05-3
English Name 3-(Di-2-thienylmethylene)-5-methoxy-1,1-dimethylpiperidinium bromide
Molecular Formula C17H22BrNOS2
Molecular Weight 400.4 g/mol
SMILES C[N+]1(CC(CC(=C(C2=CC=CS2)C3=CC=CS3)C1)OC)C.[Br-]
InChIKey QTSXMEPZSHLZFF-UHFFFAOYSA-M
Last Updated: 2026-03-19 14:17

Related Q&A

Compound Q&A

How is 3-(Di-2-thienylmethylene)-5-methoxy-1,1-dimethylpiperidinium bromide (CAS: 35035-05-3) typically synthesized?

3-(Di-2-thienylmethylene)-5-methoxy-1,1-dimethylpiperidinium bromide is typically synthesized throug...

Compound Q&A

What industries use 3-(Di-2-thienylmethylene)-5-methoxy-1,1-dimethylpiperidinium bromide (CAS: 35035-05-3)?

3-(Di-2-thienylmethylene)-5-methoxy-1,1-dimethylpiperidinium bromide is used in various industries, ...

Compound Q&A

What precautions should be taken when handling 3-(Di-2-thienylmethylene)-5-methoxy-1,1-dimethylpiperidinium bromide (CAS: 35035-05-3)?

When handling 3-(Di-2-thienylmethylene)-5-methoxy-1,1-dimethylpiperidinium bromide, appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...