Compound Q&A

What industries use 2-Methyl-2-propanyl 3-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate (CAS: 1289387-40-1)?

Answer

2-Methyl-2-propanyl 3-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate
2-Methyl-2-propanyl 3-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate is primarily used in the pharmaceutical industry as an intermediate in the synthesis of certain drugs. It is also relevant in the polymer industry for the development of new materials. Additionally, it can be utilized in the production of sensors and as a chemical reagent in academic and industrial laboratories.

About

English Name 2-Methyl-2-propanyl 3-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate
Molecular Formula C13H24N2O2
Molecular Weight 240.35 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(C1)CNC2CC2
InChIKey MAJQJMXQZAKIHB-UHFFFAOYSA-N
Last Updated: 2026-03-19 14:17

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate (CAS: 1289387-40-1)?

2-Methyl-2-propanyl 3-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate is an organic compound wit...

Compound Q&A

How is 2-Methyl-2-propanyl 3-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate (CAS: 1289387-40-1) typically synthesized?

2-Methyl-2-propanyl 3-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate can be synthesized via a m...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 3-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate (CAS: 1289387-40-1)?

When handling 2-Methyl-2-propanyl 3-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate, it is essen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...