Compound Q&A

How is 2-Methyl-2-propanyl 3-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate (CAS: 1289387-40-1) typically synthesized?

Answer

2-Methyl-2-propanyl 3-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate
2-Methyl-2-propanyl 3-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate can be synthesized via a multi-step process involving the reaction of a pyrrolidine derivative with a cyclopropylamine. Commonly, this involves the use of a catalytic amount of a Lewis acid, such as aluminum chloride, to facilitate the reaction. The product is obtained with a good yield and high selectivity, making it a suitable intermediate for further chemical transformations.

About

English Name 2-Methyl-2-propanyl 3-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate
Molecular Formula C13H24N2O2
Molecular Weight 240.35 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(C1)CNC2CC2
InChIKey MAJQJMXQZAKIHB-UHFFFAOYSA-N
Last Updated: 2026-03-19 14:17

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate (CAS: 1289387-40-1)?

2-Methyl-2-propanyl 3-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate is an organic compound wit...

Compound Q&A

What industries use 2-Methyl-2-propanyl 3-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate (CAS: 1289387-40-1)?

2-Methyl-2-propanyl 3-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate is primarily used in the p...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 3-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate (CAS: 1289387-40-1)?

When handling 2-Methyl-2-propanyl 3-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate, it is essen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...