Compound Q&A

What industries use N,N'-4,4'-Biphenyldiyldiisonicotinamide (CAS: 55119-40-9)?

Answer

N,N'-4,4'-Biphenyldiyldiisonicotinamide
N,N'-4,4'-Biphenyldiyldiisonicotinamide is used in various industries, including pharmaceuticals, where it serves as a precursor for drug synthesis. It is also utilized in the production of polymeric materials, sensors, and semiconductors due to its unique chemical structure and reactivity. Its applications are primarily in the chemical and electronic sectors.

About

CAS No 55119-40-9
English Name N,N'-4,4'-Biphenyldiyldiisonicotinamide
Molecular Formula C24H18N4O2
Molecular Weight 394.43 g/mol
SMILES c1cc(ccc1c2ccc(cc2)NC(=O)c3ccncc3)NC(=O)c4ccncc4
InChIKey XNJSGAADEFNRJX-UHFFFAOYSA-N
Last Updated: 2026-03-19 14:17

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N'-4,4'-Biphenyldiyldiisonicotinamide (CAS: 55119-40-9)?

N,N'-4,4'-Biphenyldiyldiisonicotinamide is a white crystalline solid with a molecular weight of appr...

Compound Q&A

How is N,N'-4,4'-Biphenyldiyldiisonicotinamide (CAS: 55119-40-9) typically synthesized?

N,N'-4,4'-Biphenyldiyldiisonicotinamide is typically synthesized through the condensation of 4,4'-bi...

Compound Q&A

What precautions should be taken when handling N,N'-4,4'-Biphenyldiyldiisonicotinamide (CAS: 55119-40-9)?

When handling N,N'-4,4'-Biphenyldiyldiisonicotinamide, it is essential to use appropriate personal p...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...