Compound Q&A

What are the physical and chemical properties of N,N'-4,4'-Biphenyldiyldiisonicotinamide (CAS: 55119-40-9)?

Answer

N,N'-4,4'-Biphenyldiyldiisonicotinamide
N,N'-4,4'-Biphenyldiyldiisonicotinamide is a white crystalline solid with a molecular weight of approximately 426.33 g/mol. It is slightly soluble in water but soluble in organic solvents like ethanol and acetone. Chemically, it is stable under normal conditions but can react with strong acids or bases. It has good thermal stability and is used as a precursor in various chemical processes.

About

CAS No 55119-40-9
English Name N,N'-4,4'-Biphenyldiyldiisonicotinamide
Molecular Formula C24H18N4O2
Molecular Weight 394.43 g/mol
SMILES c1cc(ccc1c2ccc(cc2)NC(=O)c3ccncc3)NC(=O)c4ccncc4
InChIKey XNJSGAADEFNRJX-UHFFFAOYSA-N
Last Updated: 2026-03-19 14:17

Related Q&A

Compound Q&A

How is N,N'-4,4'-Biphenyldiyldiisonicotinamide (CAS: 55119-40-9) typically synthesized?

N,N'-4,4'-Biphenyldiyldiisonicotinamide is typically synthesized through the condensation of 4,4'-bi...

Compound Q&A

What industries use N,N'-4,4'-Biphenyldiyldiisonicotinamide (CAS: 55119-40-9)?

N,N'-4,4'-Biphenyldiyldiisonicotinamide is used in various industries, including pharmaceuticals, wh...

Compound Q&A

What precautions should be taken when handling N,N'-4,4'-Biphenyldiyldiisonicotinamide (CAS: 55119-40-9)?

When handling N,N'-4,4'-Biphenyldiyldiisonicotinamide, it is essential to use appropriate personal p...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...