Compound Q&A

How should 2-[(3-Aminophenyl)sulfonyl]ethyl hydrogen sulfate (CAS: 2494-88-4) be stored?

Answer

2-[(3-Aminophenyl)sulfonyl]ethyl hydrogen sulfate
2-[(3-Aminophenyl)sulfonyl]ethyl hydrogen sulfate should be stored in a well-ventilated area, away from heat, direct sunlight, and sources of ignition. Keep it in tightly sealed, airtight containers to prevent moisture absorption. Store it at a temperature below 25°C (77°F) to maintain its stability and avoid decomposition. Proper storage conditions are crucial to ensure the compound remains safe and effective for use.

About

CAS No 2494-88-4
English Name 2-[(3-Aminophenyl)sulfonyl]ethyl hydrogen sulfate
Molecular Formula C8H11NO6S2
Molecular Weight 281.31 g/mol
SMILES C1=CC(=CC(=C1)S(=O)(=O)CCOS(=O)(=O)O)N
InChIKey BCLOBWIFURSERL-UHFFFAOYSA-N
Last Updated: 2026-03-19 05:36

Related Q&A

Compound Q&A

What is 2-[(3-Aminophenyl)sulfonyl]ethyl hydrogen sulfate (CAS: 2494-88-4)?

2-[(3-Aminophenyl)sulfonyl]ethyl hydrogen sulfate is a compound with the CAS number 2494-88-4. It is...

Compound Q&A

What are the main uses of 2-[(3-Aminophenyl)sulfonyl]ethyl hydrogen sulfate (CAS: 2494-88-4)?

2-[(3-Aminophenyl)sulfonyl]ethyl hydrogen sulfate is primarily used in the pharmaceutical industry a...

Compound Q&A

Is 2-[(3-Aminophenyl)sulfonyl]ethyl hydrogen sulfate (CAS: 2494-88-4) safe?

2-[(3-Aminophenyl)sulfonyl]ethyl hydrogen sulfate, while generally safe under proper handling, requi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...