Compound Q&A

What are the main uses of 2-[(3-Aminophenyl)sulfonyl]ethyl hydrogen sulfate (CAS: 2494-88-4)?

Answer

2-[(3-Aminophenyl)sulfonyl]ethyl hydrogen sulfate
2-[(3-Aminophenyl)sulfonyl]ethyl hydrogen sulfate is primarily used in the pharmaceutical industry as an intermediate for the synthesis of certain drugs. It is also utilized in research for its biological activity and as a reagent in chemical reactions. Its usage in other sectors is limited due to its specialized properties.

About

CAS No 2494-88-4
English Name 2-[(3-Aminophenyl)sulfonyl]ethyl hydrogen sulfate
Molecular Formula C8H11NO6S2
Molecular Weight 281.31 g/mol
SMILES C1=CC(=CC(=C1)S(=O)(=O)CCOS(=O)(=O)O)N
InChIKey BCLOBWIFURSERL-UHFFFAOYSA-N
Last Updated: 2026-03-19 05:36

Related Q&A

Compound Q&A

What is 2-[(3-Aminophenyl)sulfonyl]ethyl hydrogen sulfate (CAS: 2494-88-4)?

2-[(3-Aminophenyl)sulfonyl]ethyl hydrogen sulfate is a compound with the CAS number 2494-88-4. It is...

Compound Q&A

Is 2-[(3-Aminophenyl)sulfonyl]ethyl hydrogen sulfate (CAS: 2494-88-4) safe?

2-[(3-Aminophenyl)sulfonyl]ethyl hydrogen sulfate, while generally safe under proper handling, requi...

Compound Q&A

How should 2-[(3-Aminophenyl)sulfonyl]ethyl hydrogen sulfate (CAS: 2494-88-4) be stored?

2-[(3-Aminophenyl)sulfonyl]ethyl hydrogen sulfate should be stored in a well-ventilated area, away f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...