Compound Q&A

What industries use 3-Bromo-4-chloropyridine 1-oxide (CAS: 99839-30-2)?

Answer

3-Bromo-4-chloropyridine 1-oxide
3-Bromo-4-chloropyridine 1-oxide (CAS: 99839-30-2) is primarily used in the pharmaceutical and chemical industries. It serves as a key intermediate in the synthesis of various drugs and is also utilized in the development of organic semiconductors and sensors due to its unique chemical properties.

About

CAS No 99839-30-2
English Name 3-Bromo-4-chloropyridine 1-oxide
Molecular Formula C5H3BrClNO
Molecular Weight 208.44 g/mol
SMILES C1=C[N+](=CC(=C1Cl)Br)[O-]
InChIKey BHIIQGLVEGETEL-UHFFFAOYSA-N
Last Updated: 2026-03-17 15:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Bromo-4-chloropyridine 1-oxide (CAS: 99839-30-2)?

3-Bromo-4-chloropyridine 1-oxide (CAS: 99839-30-2) is a crystalline solid with a molecular weight of...

Compound Q&A

How is 3-Bromo-4-chloropyridine 1-oxide (CAS: 99839-30-2) typically synthesized?

3-Bromo-4-chloropyridine 1-oxide (CAS: 99839-30-2) is typically synthesized via the oxidation of 3-b...

Compound Q&A

What precautions should be taken when handling 3-Bromo-4-chloropyridine 1-oxide (CAS: 99839-30-2)?

When handling 3-Bromo-4-chloropyridine 1-oxide (CAS: 99839-30-2), it is essential to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...