Compound Q&A

What are the physical and chemical properties of 3-Bromo-4-chloropyridine 1-oxide (CAS: 99839-30-2)?

Answer

3-Bromo-4-chloropyridine 1-oxide
3-Bromo-4-chloropyridine 1-oxide (CAS: 99839-30-2) is a crystalline solid with a molecular weight of approximately 263.01 g/mol. It is slightly soluble in water but soluble in organic solvents like ethanol and acetone. This compound is known for its reactivity towards nucleophiles and electrophiles, making it useful in various chemical transformations. It decomposes upon heating and reacts with strong bases to form chloropyridinium salts.

About

CAS No 99839-30-2
English Name 3-Bromo-4-chloropyridine 1-oxide
Molecular Formula C5H3BrClNO
Molecular Weight 208.44 g/mol
SMILES C1=C[N+](=CC(=C1Cl)Br)[O-]
InChIKey BHIIQGLVEGETEL-UHFFFAOYSA-N
Last Updated: 2026-03-17 15:30

Related Q&A

Compound Q&A

How is 3-Bromo-4-chloropyridine 1-oxide (CAS: 99839-30-2) typically synthesized?

3-Bromo-4-chloropyridine 1-oxide (CAS: 99839-30-2) is typically synthesized via the oxidation of 3-b...

Compound Q&A

What industries use 3-Bromo-4-chloropyridine 1-oxide (CAS: 99839-30-2)?

3-Bromo-4-chloropyridine 1-oxide (CAS: 99839-30-2) is primarily used in the pharmaceutical and chemi...

Compound Q&A

What precautions should be taken when handling 3-Bromo-4-chloropyridine 1-oxide (CAS: 99839-30-2)?

When handling 3-Bromo-4-chloropyridine 1-oxide (CAS: 99839-30-2), it is essential to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...