Compound Q&A

How is 19,20-Epoxycytochalasin D (CAS: 191349-10-7) typically synthesized?

Answer

19,20-Epoxycytochalasin D
19,20-Epoxycytochalasin D is typically synthesized via a multi-step organic synthesis route involving protecting group chemistry, epoxidation, and subsequent ring-opening reactions. Commonly used catalysts include metal complexes and organocatalysts. The overall yield is moderate, with selectivity and purity controlled through careful manipulation of reaction conditions.

About

English Name 19,20-Epoxycytochalasin D
Molecular Formula C30H37NO7
Molecular Weight 523.62 g/mol
SMILES CC(=O)O[C@@H]1[C@@H]2O[C@H]2[C@@](C)(O)C(=O)[C@H](C/C=C/[C@@H]2[C@]31C(=O)N[C@H]([C@@H]3[C@H](C)C(=C)[C@H]2O)Cc1ccccc1)C
InChIKey WHJRAYUHVRYTTH-MQQXPATASA-N
Last Updated: 2026-03-17 15:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 19,20-Epoxycytochalasin D (CAS: 191349-10-7)?

19,20-Epoxycytochalasin D is a yellow crystalline compound with a molecular weight of approximately ...

Compound Q&A

What industries use 19,20-Epoxycytochalasin D (CAS: 191349-10-7)?

19,20-Epoxycytochalasin D is primarily used in pharmaceutical research, particularly in cancer thera...

Compound Q&A

What precautions should be taken when handling 19,20-Epoxycytochalasin D (CAS: 191349-10-7)?

When handling 19,20-Epoxycytochalasin D, it is essential to wear appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...