Compound Q&A

What are the physical and chemical properties of 19,20-Epoxycytochalasin D (CAS: 191349-10-7)?

Answer

19,20-Epoxycytochalasin D
19,20-Epoxycytochalasin D is a yellow crystalline compound with a molecular weight of approximately 602.47 g/mol. It has low water solubility and moderate solubility in organic solvents. The compound is reactive towards nucleophiles and can undergo epoxide ring opening under basic conditions. It is stable under neutral and acidic conditions but should be protected from moisture and light.

About

English Name 19,20-Epoxycytochalasin D
Molecular Formula C30H37NO7
Molecular Weight 523.62 g/mol
SMILES CC(=O)O[C@@H]1[C@@H]2O[C@H]2[C@@](C)(O)C(=O)[C@H](C/C=C/[C@@H]2[C@]31C(=O)N[C@H]([C@@H]3[C@H](C)C(=C)[C@H]2O)Cc1ccccc1)C
InChIKey WHJRAYUHVRYTTH-MQQXPATASA-N
Last Updated: 2026-03-17 15:30

Related Q&A

Compound Q&A

How is 19,20-Epoxycytochalasin D (CAS: 191349-10-7) typically synthesized?

19,20-Epoxycytochalasin D is typically synthesized via a multi-step organic synthesis route involvin...

Compound Q&A

What industries use 19,20-Epoxycytochalasin D (CAS: 191349-10-7)?

19,20-Epoxycytochalasin D is primarily used in pharmaceutical research, particularly in cancer thera...

Compound Q&A

What precautions should be taken when handling 19,20-Epoxycytochalasin D (CAS: 191349-10-7)?

When handling 19,20-Epoxycytochalasin D, it is essential to wear appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...