Compound Q&A

How is 5-(Trifluoromethyl)picolinamide (CAS: 22245-86-9) typically synthesized?

Answer

5-(Trifluoromethyl)picolinamide
5-(Trifluoromethyl)picolinamide is often synthesized via the reaction of 5-chloropicolinamide with trifluoromethanesulfonic anhydride. The reaction is typically carried out in the presence of a base like pyridine to facilitate the substitution reaction. The yield and selectivity of this process are generally high, making it a common method in industrial synthesis.

About

CAS No 22245-86-9
English Name 5-(Trifluoromethyl)picolinamide
Molecular Formula C7H5F3N2O
Molecular Weight 190.12399999999994 g/mol
SMILES C1=CC(=NC=C1C(F)(F)F)C(=O)N
InChIKey JUNJVRHWOHOSKU-UHFFFAOYSA-N
Last Updated: 2026-03-17 06:03

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-(Trifluoromethyl)picolinamide (CAS: 22245-86-9)?

5-(Trifluoromethyl)picolinamide is a white crystalline solid with a molecular weight of approximatel...

Compound Q&A

What industries use 5-(Trifluoromethyl)picolinamide (CAS: 22245-86-9)?

5-(Trifluoromethyl)picolinamide is used in various industries, particularly in pharmaceuticals due t...

Compound Q&A

What precautions should be taken when handling 5-(Trifluoromethyl)picolinamide (CAS: 22245-86-9)?

When handling 5-(Trifluoromethyl)picolinamide, it is important to use appropriate personal protectiv...

Compound Q&A

What are the physical and chemical properties of 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0)?

4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0) is a crys...

2040295-11-04,4',4'',4'''-(1,1,2...
Compound Q&A

Are there alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol (CAS: 564-73-8) in synthesis?

There are several alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol in syn...

564-73-8(3beta)-Abieta-8,11,...
Compound Q&A

What are the main uses of sec-Butylhydrazine dihydrochloride (CAS: 1177361-36-2)?

Sec-Butylhydrazine dihydrochloride is mainly used as a precursor in the synthesi...

1177361-36-2sec-Butylhydrazine d...
Compound Q&A

How is BIBP3226 TFA (CAS: 1068148-47-9) typically synthesized?

BIBP3226 TFA is synthesized via a multi-step process involving amino acid deriva...

1068148-47-9BIBP3226 TFA