Compound Q&A

What precautions should be taken when handling 1-(~2~H_7_)Naphthalenol (CAS: 124251-84-9)?

Answer

1-(~2~H_7_)Naphthalenol
When handling 1-(~2~H_7_)Naphthalenol (CAS: 124251-84-9), appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. Store the compound in a cool, dry place away from direct sunlight. Spills should be cleaned up using appropriate methods as outlined in the safety data sheet (SDS). This compound is reactive and can cause irritation or burns, so it is crucial to avoid contact with skin and eyes.

About

English Name 1-(~2~H_7_)Naphthalenol
Molecular Formula C10HD7O
Molecular Weight 151.22 g/mol
SMILES c1([2H])c([2H])c([2H])c(c2c1c([2H])c([2H])c(c2O)[2H])[2H]
InChIKey KJCVRFUGPWSIIH-GSNKEKJESA-N
Last Updated: 2026-03-17 06:03

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(~2~H_7_)Naphthalenol (CAS: 124251-84-9)?

1-(~2~H_7_)Naphthalenol (CAS: 124251-84-9) is a crystalline solid with a molecular weight of approxi...

Compound Q&A

How is 1-(~2~H_7_)Naphthalenol (CAS: 124251-84-9) typically synthesized?

1-(~2~H_7_)Naphthalenol can be synthesized via the reduction of 1-naphthol with ~2~H_7~ (deuterium),...

Compound Q&A

What industries use 1-(~2~H_7_)Naphthalenol (CAS: 124251-84-9)?

1-(~2~H_7_)Naphthalenol (CAS: 124251-84-9) is primarily used in the pharmaceutical and polymer indus...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...