Compound Q&A

What are the physical and chemical properties of 1-(~2~H_7_)Naphthalenol (CAS: 124251-84-9)?

Answer

1-(~2~H_7_)Naphthalenol
1-(~2~H_7_)Naphthalenol (CAS: 124251-84-9) is a crystalline solid with a molecular weight of approximately 191.2 g/mol. It has a pKa of around 12 and is slightly soluble in water. This compound is reactive, particularly towards base-catalyzed reactions. It exhibits good solubility in organic solvents like benzene and chloroform.

About

English Name 1-(~2~H_7_)Naphthalenol
Molecular Formula C10HD7O
Molecular Weight 151.22 g/mol
SMILES c1([2H])c([2H])c([2H])c(c2c1c([2H])c([2H])c(c2O)[2H])[2H]
InChIKey KJCVRFUGPWSIIH-GSNKEKJESA-N
Last Updated: 2026-03-17 06:03

Related Q&A

Compound Q&A

How is 1-(~2~H_7_)Naphthalenol (CAS: 124251-84-9) typically synthesized?

1-(~2~H_7_)Naphthalenol can be synthesized via the reduction of 1-naphthol with ~2~H_7~ (deuterium),...

Compound Q&A

What industries use 1-(~2~H_7_)Naphthalenol (CAS: 124251-84-9)?

1-(~2~H_7_)Naphthalenol (CAS: 124251-84-9) is primarily used in the pharmaceutical and polymer indus...

Compound Q&A

What precautions should be taken when handling 1-(~2~H_7_)Naphthalenol (CAS: 124251-84-9)?

When handling 1-(~2~H_7_)Naphthalenol (CAS: 124251-84-9), appropriate personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...