Compound Q&A

What precautions should be taken when handling His-Pro-Phe-Phe-His-Leu-D-Leu-Val-Tyr (CAS: 50410-01-0)?

Answer

His-Pro-Phe-His-Leu-D-Leu-Val-Tyr
When handling His-Pro-Phe-His-Leu-D-Leu-Val-Tyr (CAS: 50410-01-0), it is crucial to wear appropriate personal protective equipment (PPE) such as gloves and goggles. The compound should be stored in a cool, dry place away from direct sunlight and heat sources. If a spill occurs, it should be cleaned up using appropriate absorbent materials. Always refer to the safety data sheet (SDS) for detailed information on handling and disposing of the compound safely.

About

CAS No 50410-01-0
English Name His-Pro-Phe-His-Leu-D-Leu-Val-Tyr
Molecular Formula C37H62N10O12
Molecular Weight 838.95 g/mol
SMILES CC(C)CC(C(=O)NC(CC(C)C)C(=O)NC(C(C)C)C(=O)NC(CC1=CC=C(C=C1)O)C(=O)O)NC(=O)C(CC2=CN=CN2)NC(=O)C(CC3=CC=CC=C3)NC(=O)C4CCCN4C(=O)C(CC5=CN=CN5)N
InChIKey IEYVLEBHKMUSNL-WXZJYPCGSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of His-Pro-Phe-His-Leu-D-Leu-Val-Tyr (CAS: 50410-01-0)?

His-Pro-Phe-His-Leu-D-Leu-Val-Tyr (CAS: 50410-01-0) is a complex cyclic peptide with a molecular wei...

Compound Q&A

How is His-Pro-Phe-His-Leu-D-Leu-Val-Tyr (CAS: 50410-01-0) typically synthesized?

His-Pro-Phe-His-Leu-D-Leu-Val-Tyr (CAS: 50410-01-0) is synthesized using solid-phase peptide synthes...

Compound Q&A

What industries use His-Pro-Phe-His-Leu-D-Leu-Val-Tyr (CAS: 50410-01-0)?

His-Pro-Phe-His-Leu-D-Leu-Val-Tyr (CAS: 50410-01-0) is used in the pharmaceutical industry for its p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...